C21H25NO4S — CID 8701050
[2-(2-methylsulfanylanilino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate (PubChem CID 8701050) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate.
| Compound Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 8701050 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate |
| SMILES | CSc1ccccc1NC(=O)COC(=O)COc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C21H25NO4S/c1-21(2,3)15-9-5-7-11-17(15)25-14-20(24)26-13-19(23)22-16-10-6-8-12-18(16)27-4/h5-12H,13-14H2,1-4H3,(H,22,23) |
| InChIKey | CCKLNWUYQUDZLC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |