C13H14ClNO6 — CID 3935127
methyl 2-[[2-[2-(4-chlorophenoxy)acetyl]oxyacetyl]amino]acetate (PubChem CID 3935127) has the molecular formula C13H14ClNO6 and a molecular weight of 315.71 g/mol. Its IUPAC name is methyl 2-[[2-[2-(4-chlorophenoxy)acetyl]oxyacetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[2-(4-chlorophenoxy)acetyl]oxyacetyl]amino]acetate |
|---|---|
| PubChem CID | 3935127 |
| Molecular Formula | C13H14ClNO6 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | methyl 2-[[2-[2-(4-chlorophenoxy)acetyl]oxyacetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)COC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClNO6/c1-19-12(17)6-15-11(16)7-21-13(18)8-20-10-4-2-9(14)3-5-10/h2-5H,6-8H2,1H3,(H,15,16) |
| InChIKey | IUTXPXXCHWJKKL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |