C12H14N2O4S — CID 24690991
methyl 2-[[2-(4-carbamothioylphenoxy)acetyl]amino]acetate (PubChem CID 24690991) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is methyl 2-[[2-(4-carbamothioylphenoxy)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(4-carbamothioylphenoxy)acetyl]amino]acetate |
|---|---|
| PubChem CID | 24690991 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | methyl 2-[[2-(4-carbamothioylphenoxy)acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)COc1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C12H14N2O4S/c1-17-11(16)6-14-10(15)7-18-9-4-2-8(3-5-9)12(13)19/h2-5H,6-7H2,1H3,(H2,13,19)(H,14,15) |
| InChIKey | GODQGPZRLPGNHM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|