C13H15NO6 — CID 2406119
[2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl] 4-methoxybenzoate (PubChem CID 2406119) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is [2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl] 4-methoxybenzoate.
| Compound Name | [2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 2406119 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | [2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl] 4-methoxybenzoate |
| SMILES | COC(=O)CNC(=O)COC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H15NO6/c1-18-10-5-3-9(4-6-10)13(17)20-8-11(15)14-7-12(16)19-2/h3-6H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | DVDSUBUGIRVYPC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |