C19H18ClNO5S — CID 8815875
[2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate (PubChem CID 8815875) has the molecular formula C19H18ClNO5S and a molecular weight of 407.88 g/mol. Its IUPAC name is [2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate.
| Compound Name | [2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 8815875 |
| Molecular Formula | C19H18ClNO5S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | [2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)CNC(=O)COC(=O)c1ccc(CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H18ClNO5S/c1-25-18(23)10-21-17(22)11-26-19(24)14-4-2-13(3-5-14)12-27-16-8-6-15(20)7-9-16/h2-9H,10-12H2,1H3,(H,21,22) |
| InChIKey | CYCYCBXAJIWPGF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |