C12H14ClNO3S — CID 8552014
methyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]acetate (PubChem CID 8552014) has the molecular formula C12H14ClNO3S and a molecular weight of 287.77 g/mol. Its IUPAC name is methyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 8552014 |
| Molecular Formula | C12H14ClNO3S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | methyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)CSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClNO3S/c1-17-12(16)6-14-11(15)8-18-7-9-2-4-10(13)5-3-9/h2-5H,6-8H2,1H3,(H,14,15) |
| InChIKey | AHKFOWJNZRJZLV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |