C13H16ClNO4S — CID 43407113
methyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]-3-hydroxypropanoate (PubChem CID 43407113) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is methyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 43407113 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | methyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)CSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClNO4S/c1-19-13(18)11(6-16)15-12(17)8-20-7-9-2-4-10(14)5-3-9/h2-5,11,16H,6-8H2,1H3,(H,15,17) |
| InChIKey | AQDVBCWILZNIFG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |