C14H18ClNO3S — CID 61343328
ethyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]propanoate (PubChem CID 61343328) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is ethyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]propanoate.
| Compound Name | ethyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 61343328 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | ethyl 2-[[2-[(4-chlorophenyl)methylsulfanyl]acetyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)CSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO3S/c1-3-19-14(18)10(2)16-13(17)9-20-8-11-4-6-12(15)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H,16,17) |
| InChIKey | UPUYFVZBDILBPD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |