C12H16ClNO3S2 — CID 47368145
ethyl 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]propanoate (PubChem CID 47368145) has the molecular formula C12H16ClNO3S2 and a molecular weight of 321.85 g/mol. Its IUPAC name is ethyl 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]propanoate.
| Compound Name | ethyl 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 47368145 |
| Molecular Formula | C12H16ClNO3S2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | ethyl 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)CSCc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H16ClNO3S2/c1-3-17-12(16)8(2)14-11(15)7-18-6-9-4-5-10(13)19-9/h4-5,8H,3,6-7H2,1-2H3,(H,14,15) |
| InChIKey | NPUHPYCKBMPUKL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |