C10H12ClNO4S2 — CID 43171672
2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 43171672) has the molecular formula C10H12ClNO4S2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 43171672 |
| Molecular Formula | C10H12ClNO4S2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 2-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | O=C(CSCc1ccc(Cl)s1)NC(CO)C(=O)O |
| InChI | InChI=1S/C10H12ClNO4S2/c11-8-2-1-6(18-8)4-17-5-9(14)12-7(3-13)10(15)16/h1-2,7,13H,3-5H2,(H,12,14)(H,15,16) |
| InChIKey | PRKPYMQVMLJBMR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |