C10H13ClN2O4S — CID 61439670
(2S)-2-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-3-hydroxypropanoic acid (PubChem CID 61439670) has the molecular formula C10H13ClN2O4S and a molecular weight of 292.74 g/mol. Its IUPAC name is (2S)-2-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61439670 |
| Molecular Formula | C10H13ClN2O4S |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | (2S)-2-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C10H13ClN2O4S/c1-13(4-6-2-3-8(11)18-6)10(17)12-7(5-14)9(15)16/h2-3,7,14H,4-5H2,1H3,(H,12,17)(H,15,16)/t7-/m0/s1 |
| InChIKey | WTVBGFDDQYHCNC-ZETCQYMHSA-N |
| XLogP | 0.99 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |