C11H15ClN2O4S — CID 114144624
3-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-2-methoxypropanoic acid (PubChem CID 114144624) has the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. Its IUPAC name is 3-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-2-methoxypropanoic acid.
| Compound Name | 3-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 114144624 |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 3-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-2-methoxypropanoic acid |
| SMILES | COC(CNC(=O)N(C)Cc1ccc(Cl)s1)C(=O)O |
| InChI | InChI=1S/C11H15ClN2O4S/c1-14(6-7-3-4-9(12)19-7)11(17)13-5-8(18-2)10(15)16/h3-4,8H,5-6H2,1-2H3,(H,13,17)(H,15,16) |
| InChIKey | AYQXVCMWIUQZIU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |