C10H15ClN2O2S — CID 81083115
2-amino-N-[(5-chlorothiophen-2-yl)methyl]-3-methoxy-N-methylpropanamide (PubChem CID 81083115) has the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. Its IUPAC name is 2-amino-N-[(5-chlorothiophen-2-yl)methyl]-3-methoxy-N-methylpropanamide.
| Compound Name | 2-amino-N-[(5-chlorothiophen-2-yl)methyl]-3-methoxy-N-methylpropanamide |
|---|---|
| PubChem CID | 81083115 |
| Molecular Formula | C10H15ClN2O2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-amino-N-[(5-chlorothiophen-2-yl)methyl]-3-methoxy-N-methylpropanamide |
| SMILES | COCC(N)C(=O)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C10H15ClN2O2S/c1-13(10(14)8(12)6-15-2)5-7-3-4-9(11)16-7/h3-4,8H,5-6,12H2,1-2H3 |
| InChIKey | SLECLMBDRCUUFR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |