C10H16N2O2S — CID 81081754
2-amino-3-methoxy-N-methyl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 81081754) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-methyl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 2-amino-3-methoxy-N-methyl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 81081754 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-amino-3-methoxy-N-methyl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | COCC(N)C(=O)N(C)Cc1cccs1 |
| InChI | InChI=1S/C10H16N2O2S/c1-12(6-8-4-3-5-15-8)10(13)9(11)7-14-2/h3-5,9H,6-7,11H2,1-2H3 |
| InChIKey | GDEJUYAOFOADRT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |