C14H24N2OS — CID 65292813
6-amino-N,2-dimethyl-N-(thiophen-2-ylmethyl)heptanamide (PubChem CID 65292813) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 6-amino-N,2-dimethyl-N-(thiophen-2-ylmethyl)heptanamide.
| Compound Name | 6-amino-N,2-dimethyl-N-(thiophen-2-ylmethyl)heptanamide |
|---|---|
| PubChem CID | 65292813 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 6-amino-N,2-dimethyl-N-(thiophen-2-ylmethyl)heptanamide |
| SMILES | CC(N)CCCC(C)C(=O)N(C)Cc1cccs1 |
| InChI | InChI=1S/C14H24N2OS/c1-11(6-4-7-12(2)15)14(17)16(3)10-13-8-5-9-18-13/h5,8-9,11-12H,4,6-7,10,15H2,1-3H3 |
| InChIKey | NZWKUDPOHDQNQT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |