C11H17NO2S — CID 82846568
thiophen-2-ylmethyl 5-aminohexanoate (PubChem CID 82846568) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is thiophen-2-ylmethyl 5-aminohexanoate.
| Compound Name | thiophen-2-ylmethyl 5-aminohexanoate |
|---|---|
| PubChem CID | 82846568 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | thiophen-2-ylmethyl 5-aminohexanoate |
| SMILES | CC(N)CCCC(=O)OCc1cccs1 |
| InChI | InChI=1S/C11H17NO2S/c1-9(12)4-2-6-11(13)14-8-10-5-3-7-15-10/h3,5,7,9H,2,4,6,8,12H2,1H3 |
| InChIKey | XSOVTJFOENDTLE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |