About (2-fluorophenyl)methyl 5-aminohexanoate
(2-fluorophenyl)methyl 5-aminohexanoate (PubChem CID 82847460) has the molecular formula C13H18FNO2
and a molecular weight of 239.29 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 5-aminohexanoate.
Molecular Properties
| Compound Name | (2-fluorophenyl)methyl 5-aminohexanoate |
| PubChem CID | 82847460 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (2-fluorophenyl)methyl 5-aminohexanoate |
| SMILES | CC(N)CCCC(=O)OCc1ccccc1F |
| InChI | InChI=1S/C13H18FNO2/c1-10(15)5-4-8-13(16)17-9-11-6-2-3-7-12(11)14/h2-3,6-7,10H,4-5,8-9,15H2,1H3 |
| InChIKey | LFUSGEWTNLFESM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-fluorophenyl)methyl 5-aminohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)methyl 5-aminohexanoate?
The IUPAC name of (2-fluorophenyl)methyl 5-aminohexanoate (CID 82847460) is (2-fluorophenyl)methyl 5-aminohexanoate.
What is the SMILES notation for (2-fluorophenyl)methyl 5-aminohexanoate?
The canonical SMILES for (2-fluorophenyl)methyl 5-aminohexanoate is CC(N)CCCC(=O)OCc1ccccc1F.
What is the InChIKey of (2-fluorophenyl)methyl 5-aminohexanoate?
The InChIKey is LFUSGEWTNLFESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO2/c1-10(15)5-4-8-13(16)17-9-11-6-2-3-7-12(11)14/h2-3,6-7,10H,4-5,8-9,15H2,1H3.
What are the key properties of (2-fluorophenyl)methyl 5-aminohexanoate?
(2-fluorophenyl)methyl 5-aminohexanoate has a molecular weight of 239.29 g/mol, XLogP of 2.39, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)methyl 5-aminohexanoate is sourced from PubChem (CID 82847460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).