C13H20N2O2S — CID 7779914
(2R)-2-acetamido-N,3-dimethyl-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 7779914) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is (2R)-2-acetamido-N,3-dimethyl-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | (2R)-2-acetamido-N,3-dimethyl-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 7779914 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (2R)-2-acetamido-N,3-dimethyl-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | CC(=O)N[C@@H](C(=O)N(C)Cc1cccs1)C(C)C |
| InChI | InChI=1S/C13H20N2O2S/c1-9(2)12(14-10(3)16)13(17)15(4)8-11-6-5-7-18-11/h5-7,9,12H,8H2,1-4H3,(H,14,16)/t12-/m1/s1 |
| InChIKey | FQULJUHDCWCPCH-GFCCVEGCSA-N |
| XLogP | 1.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |