C11H19ClN2O2S — CID 120991220
2-amino-3-methoxy-N-methyl-N-(2-thiophen-2-ylethyl)propanamide;hydrochloride (PubChem CID 120991220) has the molecular formula C11H19ClN2O2S and a molecular weight of 278.80 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-methyl-N-(2-thiophen-2-ylethyl)propanamide;hydrochloride.
| Compound Name | 2-amino-3-methoxy-N-methyl-N-(2-thiophen-2-ylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120991220 |
| Molecular Formula | C11H19ClN2O2S |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-amino-3-methoxy-N-methyl-N-(2-thiophen-2-ylethyl)propanamide;hydrochloride |
| SMILES | COCC(N)C(=O)N(C)CCc1cccs1.Cl |
| InChI | InChI=1S/C11H18N2O2S.ClH/c1-13(11(14)10(12)8-15-2)6-5-9-4-3-7-16-9;/h3-4,7,10H,5-6,8,12H2,1-2H3;1H |
| InChIKey | FUNJTYZZKHEINY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |