C16H20N2OS — CID 106151574
2-amino-N-methyl-2-(4-methylphenyl)-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 106151574) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 2-amino-N-methyl-2-(4-methylphenyl)-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-amino-N-methyl-2-(4-methylphenyl)-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 106151574 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-amino-N-methyl-2-(4-methylphenyl)-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | Cc1ccc(C(N)C(=O)N(C)CCc2cccs2)cc1 |
| InChI | InChI=1S/C16H20N2OS/c1-12-5-7-13(8-6-12)15(17)16(19)18(2)10-9-14-4-3-11-20-14/h3-8,11,15H,9-10,17H2,1-2H3 |
| InChIKey | BXGYFKXPBYDEMA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |