C18H21BrN2O — CID 120668214
2-amino-N-[2-(4-bromophenyl)ethyl]-N-methyl-2-(4-methylphenyl)acetamide (PubChem CID 120668214) has the molecular formula C18H21BrN2O and a molecular weight of 361.28 g/mol. Its IUPAC name is 2-amino-N-[2-(4-bromophenyl)ethyl]-N-methyl-2-(4-methylphenyl)acetamide.
| Compound Name | 2-amino-N-[2-(4-bromophenyl)ethyl]-N-methyl-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 120668214 |
| Molecular Formula | C18H21BrN2O |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-amino-N-[2-(4-bromophenyl)ethyl]-N-methyl-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(N)C(=O)N(C)CCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C18H21BrN2O/c1-13-3-7-15(8-4-13)17(20)18(22)21(2)12-11-14-5-9-16(19)10-6-14/h3-10,17H,11-12,20H2,1-2H3 |
| InChIKey | DOEPUMFJHMLVAO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |