C14H19ClN2OS2 — CID 119271767
(2S)-2-amino-N,N-bis(thiophen-2-ylmethyl)butanamide;hydrochloride (PubChem CID 119271767) has the molecular formula C14H19ClN2OS2 and a molecular weight of 330.91 g/mol. Its IUPAC name is (2S)-2-amino-N,N-bis(thiophen-2-ylmethyl)butanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N,N-bis(thiophen-2-ylmethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119271767 |
| Molecular Formula | C14H19ClN2OS2 |
| Molecular Weight | 330.91 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (2S)-2-amino-N,N-bis(thiophen-2-ylmethyl)butanamide;hydrochloride |
| SMILES | CC[C@H](N)C(=O)N(Cc1cccs1)Cc1cccs1.Cl |
| InChI | InChI=1S/C14H18N2OS2.ClH/c1-2-13(15)14(17)16(9-11-5-3-7-18-11)10-12-6-4-8-19-12;/h3-8,13H,2,9-10,15H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | ZZZYOCKJQVUMAF-ZOWNYOTGSA-N |
| XLogP | 3.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |