C15H18BrNOS2 — CID 60953324
2-bromo-3-methyl-N,N-bis(thiophen-2-ylmethyl)butanamide (PubChem CID 60953324) has the molecular formula C15H18BrNOS2 and a molecular weight of 372.35 g/mol. Its IUPAC name is 2-bromo-3-methyl-N,N-bis(thiophen-2-ylmethyl)butanamide.
| Compound Name | 2-bromo-3-methyl-N,N-bis(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 60953324 |
| Molecular Formula | C15H18BrNOS2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 2-bromo-3-methyl-N,N-bis(thiophen-2-ylmethyl)butanamide |
| SMILES | CC(C)C(Br)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C15H18BrNOS2/c1-11(2)14(16)15(18)17(9-12-5-3-7-19-12)10-13-6-4-8-20-13/h3-8,11,14H,9-10H2,1-2H3 |
| InChIKey | VBSSYFGJUVVQPK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|