C16H22N2OS2 — CID 104903015
(2R)-2-amino-4-methyl-N,N-bis(thiophen-2-ylmethyl)pentanamide (PubChem CID 104903015) has the molecular formula C16H22N2OS2 and a molecular weight of 322.50 g/mol. Its IUPAC name is (2R)-2-amino-4-methyl-N,N-bis(thiophen-2-ylmethyl)pentanamide.
| Compound Name | (2R)-2-amino-4-methyl-N,N-bis(thiophen-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 104903015 |
| Molecular Formula | C16H22N2OS2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (2R)-2-amino-4-methyl-N,N-bis(thiophen-2-ylmethyl)pentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C16H22N2OS2/c1-12(2)9-15(17)16(19)18(10-13-5-3-7-20-13)11-14-6-4-8-21-14/h3-8,12,15H,9-11,17H2,1-2H3/t15-/m1/s1 |
| InChIKey | REUSYBVNHIUBDT-OAHLLOKOSA-N |
| XLogP | 3.71 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |