C15H20N2O2S2 — CID 61164432
(2S)-2-amino-N-(furan-2-ylmethyl)-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 61164432) has the molecular formula C15H20N2O2S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is (2S)-2-amino-N-(furan-2-ylmethyl)-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | (2S)-2-amino-N-(furan-2-ylmethyl)-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 61164432 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (2S)-2-amino-N-(furan-2-ylmethyl)-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | CSCC[C@H](N)C(=O)N(Cc1ccco1)Cc1cccs1 |
| InChI | InChI=1S/C15H20N2O2S2/c1-20-9-6-14(16)15(18)17(10-12-4-2-7-19-12)11-13-5-3-8-21-13/h2-5,7-8,14H,6,9-11,16H2,1H3/t14-/m0/s1 |
| InChIKey | BODJZJNVXICRMH-AWEZNQCLSA-N |
| XLogP | 2.95 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |