C15H24N2O2S — CID 104907713
(2R)-2-amino-N-cyclopentyl-N-(furan-2-ylmethyl)-4-methylsulfanylbutanamide (PubChem CID 104907713) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is (2R)-2-amino-N-cyclopentyl-N-(furan-2-ylmethyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-cyclopentyl-N-(furan-2-ylmethyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104907713 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (2R)-2-amino-N-cyclopentyl-N-(furan-2-ylmethyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)N(Cc1ccco1)C1CCCC1 |
| InChI | InChI=1S/C15H24N2O2S/c1-20-10-8-14(16)15(18)17(12-5-2-3-6-12)11-13-7-4-9-19-13/h4,7,9,12,14H,2-3,5-6,8,10-11,16H2,1H3/t14-/m1/s1 |
| InChIKey | HJRBZOBPHPGQEM-CQSZACIVSA-N |
| XLogP | 2.63 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |