C13H22N2O2S2 — CID 104907658
(2R)-2-amino-N-(2-methoxyethyl)-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 104907658) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-methoxyethyl)-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | (2R)-2-amino-N-(2-methoxyethyl)-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 104907658 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (2R)-2-amino-N-(2-methoxyethyl)-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | COCCN(Cc1cccs1)C(=O)[C@H](N)CCSC |
| InChI | InChI=1S/C13H22N2O2S2/c1-17-7-6-15(10-11-4-3-8-19-11)13(16)12(14)5-9-18-2/h3-4,8,12H,5-7,9-10,14H2,1-2H3/t12-/m1/s1 |
| InChIKey | VLEVBXUABOQEPH-GFCCVEGCSA-N |
| XLogP | 1.80 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |