About 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate
2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate (PubChem CID 62479012) has the molecular formula C11H17NO3S
and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate.
Molecular Properties
| Compound Name | 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate |
| PubChem CID | 62479012 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate |
| SMILES | COCCC(N)C(=O)OCCc1cccs1 |
| InChI | InChI=1S/C11H17NO3S/c1-14-6-5-10(12)11(13)15-7-4-9-3-2-8-16-9/h2-3,8,10H,4-7,12H2,1H3 |
| InChIKey | PNLBNEDBUNLHEB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate?
The IUPAC name of 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate (CID 62479012) is 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate.
What is the SMILES notation for 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate?
The canonical SMILES for 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate is COCCC(N)C(=O)OCCc1cccs1.
What is the InChIKey of 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate?
The InChIKey is PNLBNEDBUNLHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3S/c1-14-6-5-10(12)11(13)15-7-4-9-3-2-8-16-9/h2-3,8,10H,4-7,12H2,1H3.
What are the key properties of 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate?
2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate has a molecular weight of 243.33 g/mol, XLogP of 1.20, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylethyl 2-amino-4-methoxybutanoate is sourced from PubChem (CID 62479012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).