About 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate
2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate (PubChem CID 80751501) has the molecular formula C9H13NO3S
and a molecular weight of 215.27 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate.
Molecular Properties
| Compound Name | 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate |
| PubChem CID | 80751501 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate |
| SMILES | N[C@H](CO)C(=O)OCCc1cccs1 |
| InChI | InChI=1S/C9H13NO3S/c10-8(6-11)9(12)13-4-3-7-2-1-5-14-7/h1-2,5,8,11H,3-4,6,10H2/t8-/m1/s1 |
| InChIKey | MXTIWRXSZXZLPD-MRVPVSSYSA-N |
| XLogP | 0.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate?
The IUPAC name of 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate (CID 80751501) is 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate.
What is the SMILES notation for 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate?
The canonical SMILES for 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate is N[C@H](CO)C(=O)OCCc1cccs1.
What is the InChIKey of 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate?
The InChIKey is MXTIWRXSZXZLPD-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H13NO3S/c10-8(6-11)9(12)13-4-3-7-2-1-5-14-7/h1-2,5,8,11H,3-4,6,10H2/t8-/m1/s1.
What are the key properties of 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate?
2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate has a molecular weight of 215.27 g/mol, XLogP of 0.15, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylethyl (2R)-2-amino-3-hydroxypropanoate is sourced from PubChem (CID 80751501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).