About 2-thiophen-2-ylethyl nitrate
2-thiophen-2-ylethyl nitrate (PubChem CID 54344199) has the molecular formula C6H7NO3S
and a molecular weight of 173.19 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl nitrate.
Molecular Properties
| Compound Name | 2-thiophen-2-ylethyl nitrate |
| PubChem CID | 54344199 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 2-thiophen-2-ylethyl nitrate |
| SMILES | O=[N+]([O-])OCCc1cccs1 |
| InChI | InChI=1S/C6H7NO3S/c8-7(9)10-4-3-6-2-1-5-11-6/h1-2,5H,3-4H2 |
| InChIKey | UBCXIBAKCJCMTQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-thiophen-2-ylethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylethyl nitrate?
The IUPAC name of 2-thiophen-2-ylethyl nitrate (CID 54344199) is 2-thiophen-2-ylethyl nitrate.
What is the SMILES notation for 2-thiophen-2-ylethyl nitrate?
The canonical SMILES for 2-thiophen-2-ylethyl nitrate is O=[N+]([O-])OCCc1cccs1.
What is the InChIKey of 2-thiophen-2-ylethyl nitrate?
The InChIKey is UBCXIBAKCJCMTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3S/c8-7(9)10-4-3-6-2-1-5-11-6/h1-2,5H,3-4H2.
What are the key properties of 2-thiophen-2-ylethyl nitrate?
2-thiophen-2-ylethyl nitrate has a molecular weight of 173.19 g/mol, XLogP of 1.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylethyl nitrate is sourced from PubChem (CID 54344199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).