About 2-thiophen-2-ylethyl sulfite
2-thiophen-2-ylethyl sulfite (PubChem CID 175017733) has the molecular formula C6H7O3S2-
and a molecular weight of 191.25 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl sulfite.
Molecular Properties
| Compound Name | 2-thiophen-2-ylethyl sulfite |
| PubChem CID | 175017733 |
| Molecular Formula | C6H7O3S2- |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 190.98 |
| IUPAC Name | 2-thiophen-2-ylethyl sulfite |
| SMILES | O=S([O-])OCCc1cccs1 |
| InChI | InChI=1S/C6H8O3S2/c7-11(8)9-4-3-6-2-1-5-10-6/h1-2,5H,3-4H2,(H,7,8)/p-1 |
| InChIKey | SWTDOHRQLDQDRZ-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-thiophen-2-ylethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylethyl sulfite?
The IUPAC name of 2-thiophen-2-ylethyl sulfite (CID 175017733) is 2-thiophen-2-ylethyl sulfite.
What is the SMILES notation for 2-thiophen-2-ylethyl sulfite?
The canonical SMILES for 2-thiophen-2-ylethyl sulfite is O=S([O-])OCCc1cccs1.
What is the InChIKey of 2-thiophen-2-ylethyl sulfite?
The InChIKey is SWTDOHRQLDQDRZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8O3S2/c7-11(8)9-4-3-6-2-1-5-10-6/h1-2,5H,3-4H2,(H,7,8)/p-1.
What are the key properties of 2-thiophen-2-ylethyl sulfite?
2-thiophen-2-ylethyl sulfite has a molecular weight of 191.25 g/mol, XLogP of 1.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylethyl sulfite is sourced from PubChem (CID 175017733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).