C11H10O3S2 — CID 63774713
3-(2-thiophen-2-ylethoxy)thiophene-2-carboxylic acid (PubChem CID 63774713) has the molecular formula C11H10O3S2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-(2-thiophen-2-ylethoxy)thiophene-2-carboxylic acid.
| Compound Name | 3-(2-thiophen-2-ylethoxy)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63774713 |
| Molecular Formula | C11H10O3S2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 3-(2-thiophen-2-ylethoxy)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1OCCc1cccs1 |
| InChI | InChI=1S/C11H10O3S2/c12-11(13)10-9(4-7-16-10)14-5-3-8-2-1-6-15-8/h1-2,4,6-7H,3,5H2,(H,12,13) |
| InChIKey | BROCWRWKBZUFNG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |