C20H26O10S2 — CID 132917329
3-[2-[2-[2-[2-[2-(2-carboxythiophen-3-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]thiophene-2-carboxylic acid (PubChem CID 132917329) has the molecular formula C20H26O10S2 and a molecular weight of 490.55 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[2-(2-carboxythiophen-3-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]thiophene-2-carboxylic acid.
| Compound Name | 3-[2-[2-[2-[2-[2-(2-carboxythiophen-3-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 132917329 |
| Molecular Formula | C20H26O10S2 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 3-[2-[2-[2-[2-[2-(2-carboxythiophen-3-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1OCCOCCOCCOCCOCCOc1ccsc1C(=O)O |
| InChI | InChI=1S/C20H26O10S2/c21-19(22)17-15(1-13-31-17)29-11-9-27-7-5-25-3-4-26-6-8-28-10-12-30-16-2-14-32-18(16)20(23)24/h1-2,13-14H,3-12H2,(H,21,22)(H,23,24) |
| InChIKey | GUUDCHQQENQTJA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|