C13H11BrO5S2 — CID 63338403
3-[2-(4-bromophenyl)sulfonylethoxy]thiophene-2-carboxylic acid (PubChem CID 63338403) has the molecular formula C13H11BrO5S2 and a molecular weight of 391.26 g/mol. Its IUPAC name is 3-[2-(4-bromophenyl)sulfonylethoxy]thiophene-2-carboxylic acid.
| Compound Name | 3-[2-(4-bromophenyl)sulfonylethoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63338403 |
| Molecular Formula | C13H11BrO5S2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 389.92 |
| IUPAC Name | 3-[2-(4-bromophenyl)sulfonylethoxy]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1OCCS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H11BrO5S2/c14-9-1-3-10(4-2-9)21(17,18)8-6-19-11-5-7-20-12(11)13(15)16/h1-5,7H,6,8H2,(H,15,16) |
| InChIKey | UQDDWTJMVXOKPU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |