C22H22NO8S2- — CID 5073116
N-[3,4-bis[2-(benzenesulfonyl)ethoxy]phenyl]-N-oxidohydroxylamine (PubChem CID 5073116) has the molecular formula C22H22NO8S2- and a molecular weight of 492.55 g/mol. Its IUPAC name is N-[3,4-bis[2-(benzenesulfonyl)ethoxy]phenyl]-N-oxidohydroxylamine.
| Compound Name | N-[3,4-bis[2-(benzenesulfonyl)ethoxy]phenyl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 5073116 |
| Molecular Formula | C22H22NO8S2- |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | N-[3,4-bis[2-(benzenesulfonyl)ethoxy]phenyl]-N-oxidohydroxylamine |
| SMILES | O=S(=O)(CCOc1ccc(N([O-])O)cc1OCCS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22NO8S2/c24-23(25)18-11-12-21(30-13-15-32(26,27)19-7-3-1-4-8-19)22(17-18)31-14-16-33(28,29)20-9-5-2-6-10-20/h1-12,17,24H,13-16H2/q-1 |
| InChIKey | LOXNAFJHDSPBSO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|