C13H18NO5- — CID 163146070
N-[3-butoxy-4-(oxiran-2-ylmethoxy)phenyl]-N-oxidohydroxylamine (PubChem CID 163146070) has the molecular formula C13H18NO5- and a molecular weight of 268.29 g/mol. Its IUPAC name is N-[3-butoxy-4-(oxiran-2-ylmethoxy)phenyl]-N-oxidohydroxylamine.
| Compound Name | N-[3-butoxy-4-(oxiran-2-ylmethoxy)phenyl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163146070 |
| Molecular Formula | C13H18NO5- |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-[3-butoxy-4-(oxiran-2-ylmethoxy)phenyl]-N-oxidohydroxylamine |
| SMILES | CCCCOc1cc(N([O-])O)ccc1OCC1CO1 |
| InChI | InChI=1S/C13H18NO5/c1-2-3-6-17-13-7-10(14(15)16)4-5-12(13)19-9-11-8-18-11/h4-5,7,11,15H,2-3,6,8-9H2,1H3/q-1 |
| InChIKey | DEDRBGXCKSBENM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|