C13H14O5 — CID 175734853
3,4-bis(oxiran-2-ylmethoxy)benzaldehyde (PubChem CID 175734853) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 3,4-bis(oxiran-2-ylmethoxy)benzaldehyde.
| Compound Name | 3,4-bis(oxiran-2-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 175734853 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 3,4-bis(oxiran-2-ylmethoxy)benzaldehyde |
| SMILES | O=Cc1ccc(OCC2CO2)c(OCC2CO2)c1 |
| InChI | InChI=1S/C13H14O5/c14-4-9-1-2-12(17-7-10-5-15-10)13(3-9)18-8-11-6-16-11/h1-4,10-11H,5-8H2 |
| InChIKey | AWOSMUUASXDQFT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|