C13H15BrO3 — CID 103134506
3-bromo-4-[(5-methyloxolan-2-yl)methoxy]benzaldehyde (PubChem CID 103134506) has the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. Its IUPAC name is 3-bromo-4-[(5-methyloxolan-2-yl)methoxy]benzaldehyde.
| Compound Name | 3-bromo-4-[(5-methyloxolan-2-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 103134506 |
| Molecular Formula | C13H15BrO3 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 3-bromo-4-[(5-methyloxolan-2-yl)methoxy]benzaldehyde |
| SMILES | CC1CCC(COc2ccc(C=O)cc2Br)O1 |
| InChI | InChI=1S/C13H15BrO3/c1-9-2-4-11(17-9)8-16-13-5-3-10(7-15)6-12(13)14/h3,5-7,9,11H,2,4,8H2,1H3 |
| InChIKey | MLTAZTGMHNMQNS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|