C13H17NO6S — CID 103135622
4-[(5-methyloxolan-2-yl)methoxy]-3-sulfamoylbenzoic acid (PubChem CID 103135622) has the molecular formula C13H17NO6S and a molecular weight of 315.35 g/mol. Its IUPAC name is 4-[(5-methyloxolan-2-yl)methoxy]-3-sulfamoylbenzoic acid.
| Compound Name | 4-[(5-methyloxolan-2-yl)methoxy]-3-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 103135622 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 4-[(5-methyloxolan-2-yl)methoxy]-3-sulfamoylbenzoic acid |
| SMILES | CC1CCC(COc2ccc(C(=O)O)cc2S(N)(=O)=O)O1 |
| InChI | InChI=1S/C13H17NO6S/c1-8-2-4-10(20-8)7-19-11-5-3-9(13(15)16)6-12(11)21(14,17)18/h3,5-6,8,10H,2,4,7H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | TYVUBRYAYAPFCA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |