C15H17ClO4 — CID 103135461
(E)-3-[3-chloro-4-[(5-methyloxolan-2-yl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 103135461) has the molecular formula C15H17ClO4 and a molecular weight of 296.75 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-[(5-methyloxolan-2-yl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-chloro-4-[(5-methyloxolan-2-yl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103135461 |
| Molecular Formula | C15H17ClO4 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (E)-3-[3-chloro-4-[(5-methyloxolan-2-yl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | CC1CCC(COc2ccc(/C=C/C(=O)O)cc2Cl)O1 |
| InChI | InChI=1S/C15H17ClO4/c1-10-2-5-12(20-10)9-19-14-6-3-11(8-13(14)16)4-7-15(17)18/h3-4,6-8,10,12H,2,5,9H2,1H3,(H,17,18)/b7-4+ |
| InChIKey | UIMYBVRVHMTUFB-QPJJXVBHSA-N |
| XLogP | 3.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|