C11H10FNO4 — CID 107689602
3-fluoro-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzaldehyde (PubChem CID 107689602) has the molecular formula C11H10FNO4 and a molecular weight of 239.20 g/mol. Its IUPAC name is 3-fluoro-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzaldehyde.
| Compound Name | 3-fluoro-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 107689602 |
| Molecular Formula | C11H10FNO4 |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-fluoro-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCC2CNC(=O)O2)c(F)c1 |
| InChI | InChI=1S/C11H10FNO4/c12-9-3-7(5-14)1-2-10(9)16-6-8-4-13-11(15)17-8/h1-3,5,8H,4,6H2,(H,13,15) |
| InChIKey | KZTZHNHJTZDRFR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|