C10H10F2N2O3 — CID 117095688
5-[(6-amino-2,3-difluorophenoxy)methyl]-1,3-oxazolidin-2-one (PubChem CID 117095688) has the molecular formula C10H10F2N2O3 and a molecular weight of 244.20 g/mol. Its IUPAC name is 5-[(6-amino-2,3-difluorophenoxy)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[(6-amino-2,3-difluorophenoxy)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 117095688 |
| Molecular Formula | C10H10F2N2O3 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 5-[(6-amino-2,3-difluorophenoxy)methyl]-1,3-oxazolidin-2-one |
| SMILES | Nc1ccc(F)c(F)c1OCC1CNC(=O)O1 |
| InChI | InChI=1S/C10H10F2N2O3/c11-6-1-2-7(13)9(8(6)12)16-4-5-3-14-10(15)17-5/h1-2,5H,3-4,13H2,(H,14,15) |
| InChIKey | KBJBJOPQJWLWAN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|