C12H15NO5 — CID 21423647
5-[(2,6-dimethoxyphenoxy)methyl]-1,3-oxazolidin-2-one (PubChem CID 21423647) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 5-[(2,6-dimethoxyphenoxy)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[(2,6-dimethoxyphenoxy)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 21423647 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 5-[(2,6-dimethoxyphenoxy)methyl]-1,3-oxazolidin-2-one |
| SMILES | COc1cccc(OC)c1OCC1CNC(=O)O1 |
| InChI | InChI=1S/C12H15NO5/c1-15-9-4-3-5-10(16-2)11(9)17-7-8-6-13-12(14)18-8/h3-5,8H,6-7H2,1-2H3,(H,13,14) |
| InChIKey | TWWPOSGEDWDEPU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |