C12H17NO7S — CID 87722700
methanesulfonic acid;5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one (PubChem CID 87722700) has the molecular formula C12H17NO7S and a molecular weight of 319.34 g/mol. Its IUPAC name is methanesulfonic acid;5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one.
| Compound Name | methanesulfonic acid;5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 87722700 |
| Molecular Formula | C12H17NO7S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | methanesulfonic acid;5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccccc1OCC1CNC(=O)O1.CS(=O)(=O)O |
| InChI | InChI=1S/C11H13NO4.CH4O3S/c1-14-9-4-2-3-5-10(9)15-7-8-6-12-11(13)16-8;1-5(2,3)4/h2-5,8H,6-7H2,1H3,(H,12,13);1H3,(H,2,3,4) |
| InChIKey | FPQMNMOYXOQGPH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|