C14H17NO6 — CID 66663546
5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one;prop-2-enoic acid (PubChem CID 66663546) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one;prop-2-enoic acid.
| Compound Name | 5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one;prop-2-enoic acid |
|---|---|
| PubChem CID | 66663546 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one;prop-2-enoic acid |
| SMILES | C=CC(=O)O.COc1ccccc1OCC1CNC(=O)O1 |
| InChI | InChI=1S/C11H13NO4.C3H4O2/c1-14-9-4-2-3-5-10(9)15-7-8-6-12-11(13)16-8;1-2-3(4)5/h2-5,8H,6-7H2,1H3,(H,12,13);2H,1H2,(H,4,5) |
| InChIKey | VYVUZEXGQCERSB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|