C11H13NO4 — CID 6257
5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one (PubChem CID 6257) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 6257 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccccc1OCC1CNC(=O)O1 |
| InChI | InChI=1S/C11H13NO4/c1-14-9-4-2-3-5-10(9)15-7-8-6-12-11(13)16-8/h2-5,8H,6-7H2,1H3,(H,12,13) |
| InChIKey | ZMNSRFNUONFLSP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |