C12H13NO5 — CID 54929992
3-methyl-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid (PubChem CID 54929992) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is 3-methyl-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid.
| Compound Name | 3-methyl-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 54929992 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-methyl-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1OCC1CNC(=O)O1 |
| InChI | InChI=1S/C12H13NO5/c1-7-3-2-4-9(11(14)15)10(7)17-6-8-5-13-12(16)18-8/h2-4,8H,5-6H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | PYZXIZGFXCXSAJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |