C13H15NO5 — CID 60673999
ethyl 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoate (PubChem CID 60673999) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is ethyl 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoate.
| Compound Name | ethyl 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 60673999 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | ethyl 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCC2CNC(=O)O2)cc1 |
| InChI | InChI=1S/C13H15NO5/c1-2-17-12(15)9-3-5-10(6-4-9)18-8-11-7-14-13(16)19-11/h3-6,11H,2,7-8H2,1H3,(H,14,16) |
| InChIKey | QJVXXNYMYJFYPP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |