C26H30O8 — CID 102495906
6-[4-(oxiran-2-ylmethoxy)benzoyl]oxyhexyl 4-(oxiran-2-ylmethoxy)benzoate (PubChem CID 102495906) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is 6-[4-(oxiran-2-ylmethoxy)benzoyl]oxyhexyl 4-(oxiran-2-ylmethoxy)benzoate.
| Compound Name | 6-[4-(oxiran-2-ylmethoxy)benzoyl]oxyhexyl 4-(oxiran-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 102495906 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 6-[4-(oxiran-2-ylmethoxy)benzoyl]oxyhexyl 4-(oxiran-2-ylmethoxy)benzoate |
| SMILES | O=C(OCCCCCCOC(=O)c1ccc(OCC2CO2)cc1)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C26H30O8/c27-25(19-5-9-21(10-6-19)31-15-23-17-33-23)29-13-3-1-2-4-14-30-26(28)20-7-11-22(12-8-20)32-16-24-18-34-24/h5-12,23-24H,1-4,13-18H2 |
| InChIKey | USBPMGVGWRLLAX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|