C26H22O8 — CID 101169143
bis[4-(oxiran-2-ylmethoxy)phenyl] benzene-1,4-dicarboxylate (PubChem CID 101169143) has the molecular formula C26H22O8 and a molecular weight of 462.45 g/mol. Its IUPAC name is bis[4-(oxiran-2-ylmethoxy)phenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[4-(oxiran-2-ylmethoxy)phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 101169143 |
| Molecular Formula | C26H22O8 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | bis[4-(oxiran-2-ylmethoxy)phenyl] benzene-1,4-dicarboxylate |
| SMILES | O=C(Oc1ccc(OCC2CO2)cc1)c1ccc(C(=O)Oc2ccc(OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C26H22O8/c27-25(33-21-9-5-19(6-10-21)29-13-23-15-31-23)17-1-2-18(4-3-17)26(28)34-22-11-7-20(8-12-22)30-14-24-16-32-24/h1-12,23-24H,13-16H2 |
| InChIKey | VJEOSLBNRWGNJE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|